C35H37F3O5S — CID 59757733
[3-[(E)-2-[(13S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethenyl]-4-(trifluoromethyl)phenyl]methyl 4-methylbenzenesulfonate (PubChem CID 59757733) has the molecular formula C35H37F3O5S and a molecular weight of 626.74 g/mol. Its IUPAC name is [3-[(E)-2-[(13S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethenyl]-4-(trifluoromethyl)phenyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [3-[(E)-2-[(13S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethenyl]-4-(trifluoromethyl)phenyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59757733 |
| Molecular Formula | C35H37F3O5S |
| Molecular Weight | 626.74 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | [3-[(E)-2-[(13S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]ethenyl]-4-(trifluoromethyl)phenyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCc2ccc(C(F)(F)F)c(/C=C/[C@]3(O)CCC4C5CCc6cc(O)ccc6C5CC[C@@]43C)c2)cc1 |
| InChI | InChI=1S/C35H37F3O5S/c1-22-3-8-27(9-4-22)44(41,42)43-21-23-5-12-31(35(36,37)38)25(19-23)13-17-34(40)18-15-32-30-10-6-24-20-26(39)7-11-28(24)29(30)14-16-33(32,34)2/h3-5,7-9,11-13,17,19-20,29-30,32,39-40H,6,10,14-16,18,21H2,1-2H3/b17-13+/t29?,30?,32?,33-,34-/m0/s1 |
| InChIKey | FOUOUJMKQXSWMC-PBGCFQSQSA-N |
| XLogP | 7.93 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.74 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|