C30H33F3O4 — CID 59757735
[(13S,17R)-17-hydroxy-17-[(E)-2-[5-(hydroxymethyl)-2-(trifluoromethyl)phenyl]ethenyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 59757735) has the molecular formula C30H33F3O4 and a molecular weight of 514.58 g/mol. Its IUPAC name is [(13S,17R)-17-hydroxy-17-[(E)-2-[5-(hydroxymethyl)-2-(trifluoromethyl)phenyl]ethenyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(13S,17R)-17-hydroxy-17-[(E)-2-[5-(hydroxymethyl)-2-(trifluoromethyl)phenyl]ethenyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 59757735 |
| Molecular Formula | C30H33F3O4 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | [(13S,17R)-17-hydroxy-17-[(E)-2-[5-(hydroxymethyl)-2-(trifluoromethyl)phenyl]ethenyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CCC1C2CC[C@@]2(C)C1CC[C@@]2(O)/C=C/c1cc(CO)ccc1C(F)(F)F |
| InChI | InChI=1S/C30H33F3O4/c1-18(35)37-22-5-7-23-20(16-22)4-6-25-24(23)10-12-28(2)27(25)11-14-29(28,36)13-9-21-15-19(17-34)3-8-26(21)30(31,32)33/h3,5,7-9,13,15-16,24-25,27,34,36H,4,6,10-12,14,17H2,1-2H3/b13-9+/t24?,25?,27?,28-,29-/m0/s1 |
| InChIKey | YAHMPZDZHDPPIQ-IFLTWNEUSA-N |
| XLogP | 6.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|