C19H26F2N2O2 — CID 59757761
(1S,8aS)-1-[(1S)-2-(3,5-difluorophenyl)-1-(methylamino)ethyl]-7-propyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 59757761) has the molecular formula C19H26F2N2O2 and a molecular weight of 352.43 g/mol. Its IUPAC name is (1S,8aS)-1-[(1S)-2-(3,5-difluorophenyl)-1-(methylamino)ethyl]-7-propyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (1S,8aS)-1-[(1S)-2-(3,5-difluorophenyl)-1-(methylamino)ethyl]-7-propyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 59757761 |
| Molecular Formula | C19H26F2N2O2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (1S,8aS)-1-[(1S)-2-(3,5-difluorophenyl)-1-(methylamino)ethyl]-7-propyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | CCCC1CCN2C(=O)O[C@@H]([C@H](Cc3cc(F)cc(F)c3)NC)[C@@H]2C1 |
| InChI | InChI=1S/C19H26F2N2O2/c1-3-4-12-5-6-23-17(10-12)18(25-19(23)24)16(22-2)9-13-7-14(20)11-15(21)8-13/h7-8,11-12,16-18,22H,3-6,9-10H2,1-2H3/t12?,16-,17-,18-/m0/s1 |
| InChIKey | CXZPNZFEMVSXGF-OVIUBPSUSA-N |
| XLogP | 3.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |