About 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium
2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium (PubChem CID 59757981) has the molecular formula C6H6N2VY-2
and a molecular weight of 245.98 g/mol. Its IUPAC name is 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium.
Molecular Properties
| Compound Name | 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium |
| PubChem CID | 59757981 |
| Molecular Formula | C6H6N2VY-2 |
| Molecular Weight | 245.98 g/mol |
| Exact Mass | 245.90 |
| IUPAC Name | 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium |
| SMILES | Cc1[c-]nc(C)n[c-]1.[V].[Y] |
| InChI | InChI=1S/C6H6N2.V.Y/c1-5-3-7-6(2)8-4-5;;/h1-2H3;;/q-2;; |
| InChIKey | PIVKUGLKMGRUOS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.98 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium?
The IUPAC name of 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium (CID 59757981) is 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium.
What is the SMILES notation for 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium?
The canonical SMILES for 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium is Cc1[c-]nc(C)n[c-]1.[V].[Y].
What is the InChIKey of 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium?
The InChIKey is PIVKUGLKMGRUOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2.V.Y/c1-5-3-7-6(2)8-4-5;;/h1-2H3;;/q-2;;.
What are the key properties of 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium?
2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium has a molecular weight of 245.98 g/mol, XLogP of 0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4,6-dihydropyrimidine-4,6-diide;vanadium;yttrium is sourced from PubChem (CID 59757981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).