C23H21NO3S2 — CID 59759414
2-methyl-2-[[4-[2-[4-(2-phenylethynyl)phenoxy]ethyl]-1,3-thiazol-2-yl]sulfanyl]propanoic acid (PubChem CID 59759414) has the molecular formula C23H21NO3S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-methyl-2-[[4-[2-[4-(2-phenylethynyl)phenoxy]ethyl]-1,3-thiazol-2-yl]sulfanyl]propanoic acid.
| Compound Name | 2-methyl-2-[[4-[2-[4-(2-phenylethynyl)phenoxy]ethyl]-1,3-thiazol-2-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 59759414 |
| Molecular Formula | C23H21NO3S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 2-methyl-2-[[4-[2-[4-(2-phenylethynyl)phenoxy]ethyl]-1,3-thiazol-2-yl]sulfanyl]propanoic acid |
| SMILES | CC(C)(Sc1nc(CCOc2ccc(C#Cc3ccccc3)cc2)cs1)C(=O)O |
| InChI | InChI=1S/C23H21NO3S2/c1-23(2,21(25)26)29-22-24-19(16-28-22)14-15-27-20-12-10-18(11-13-20)9-8-17-6-4-3-5-7-17/h3-7,10-13,16H,14-15H2,1-2H3,(H,25,26) |
| InChIKey | GNRBAKQWAJQCKY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|