C18H16FN3O2 — CID 59759869
3-[(1S,2R)-2-[6-(3-fluoro-4-methylphenyl)-3-pyridinyl]cyclopropyl]imidazolidine-2,4-dione (PubChem CID 59759869) has the molecular formula C18H16FN3O2 and a molecular weight of 325.34 g/mol. Its IUPAC name is 3-[(1S,2R)-2-[6-(3-fluoro-4-methylphenyl)-3-pyridinyl]cyclopropyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(1S,2R)-2-[6-(3-fluoro-4-methylphenyl)-3-pyridinyl]cyclopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59759869 |
| Molecular Formula | C18H16FN3O2 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 3-[(1S,2R)-2-[6-(3-fluoro-4-methylphenyl)-3-pyridinyl]cyclopropyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2ccc([C@H]3C[C@@H]3N3C(=O)CNC3=O)cn2)cc1F |
| InChI | InChI=1S/C18H16FN3O2/c1-10-2-3-11(6-14(10)19)15-5-4-12(8-20-15)13-7-16(13)22-17(23)9-21-18(22)24/h2-6,8,13,16H,7,9H2,1H3,(H,21,24)/t13-,16+/m1/s1 |
| InChIKey | UJRDLUGOGSOSNZ-CJNGLKHVSA-N |
| XLogP | 2.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|