C25H16F12N2O5 — CID 59760446
(5Z)-3-[4-[bis(2,2,2-trifluoroethyl)amino]-2-hydroxyphenyl]-5-[4-[bis(2,2,2-trifluoroethyl)amino]-6-oxocyclohexa-2,4-dien-1-ylidene]-4-hydroxycyclopent-3-ene-1,2-dione (PubChem CID 59760446) has the molecular formula C25H16F12N2O5 and a molecular weight of 652.39 g/mol. Its IUPAC name is (5Z)-3-[4-[bis(2,2,2-trifluoroethyl)amino]-2-hydroxyphenyl]-5-[4-[bis(2,2,2-trifluoroethyl)amino]-6-oxocyclohexa-2,4-dien-1-ylidene]-4-hydroxycyclopent-3-ene-1,2-dione.
| Compound Name | (5Z)-3-[4-[bis(2,2,2-trifluoroethyl)amino]-2-hydroxyphenyl]-5-[4-[bis(2,2,2-trifluoroethyl)amino]-6-oxocyclohexa-2,4-dien-1-ylidene]-4-hydroxycyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 59760446 |
| Molecular Formula | C25H16F12N2O5 |
| Molecular Weight | 652.39 g/mol |
| Exact Mass | 652.09 |
| IUPAC Name | (5Z)-3-[4-[bis(2,2,2-trifluoroethyl)amino]-2-hydroxyphenyl]-5-[4-[bis(2,2,2-trifluoroethyl)amino]-6-oxocyclohexa-2,4-dien-1-ylidene]-4-hydroxycyclopent-3-ene-1,2-dione |
| SMILES | O=C1C(=O)/C(=C2/C=CC(N(CC(F)(F)F)CC(F)(F)F)=CC2=O)C(O)=C1c1ccc(N(CC(F)(F)F)CC(F)(F)F)cc1O |
| InChI | InChI=1S/C25H16F12N2O5/c26-22(27,28)7-38(8-23(29,30)31)11-1-3-13(15(40)5-11)17-19(42)18(21(44)20(17)43)14-4-2-12(6-16(14)41)39(9-24(32,33)34)10-25(35,36)37/h1-6,40,42H,7-10H2/b18-14- |
| InChIKey | FYQBOBBFGNQTGL-JXAWBTAJSA-N |
| XLogP | 5.49 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|