C11H18F4O — CID 59760753
4-cyclohexyl-1,1,1,2-tetrafluoropentan-2-ol (PubChem CID 59760753) has the molecular formula C11H18F4O and a molecular weight of 242.26 g/mol. Its IUPAC name is 4-cyclohexyl-1,1,1,2-tetrafluoropentan-2-ol.
| Compound Name | 4-cyclohexyl-1,1,1,2-tetrafluoropentan-2-ol |
|---|---|
| PubChem CID | 59760753 |
| Molecular Formula | C11H18F4O |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 4-cyclohexyl-1,1,1,2-tetrafluoropentan-2-ol |
| SMILES | CC(CC(O)(F)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C11H18F4O/c1-8(9-5-3-2-4-6-9)7-10(12,16)11(13,14)15/h8-9,16H,2-7H2,1H3 |
| InChIKey | YYYSDFRSWKOMBS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |