About (2E,3E)-2,3-di(ethylidene)quinoxaline
(2E,3E)-2,3-di(ethylidene)quinoxaline (PubChem CID 59760795) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is (2E,3E)-2,3-di(ethylidene)quinoxaline.
Molecular Properties
| Compound Name | (2E,3E)-2,3-di(ethylidene)quinoxaline |
| PubChem CID | 59760795 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (2E,3E)-2,3-di(ethylidene)quinoxaline |
| SMILES | C/C=c1/nc2ccccc2n/c1=C/C |
| InChI | InChI=1S/C12H12N2/c1-3-9-10(4-2)14-12-8-6-5-7-11(12)13-9/h3-8H,1-2H3/b9-3+,10-4+ |
| InChIKey | HQZJEAQKCBUGIX-LQIBPGRFSA-N |
| XLogP | 1.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E,3E)-2,3-di(ethylidene)quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-2,3-di(ethylidene)quinoxaline?
The IUPAC name of (2E,3E)-2,3-di(ethylidene)quinoxaline (CID 59760795) is (2E,3E)-2,3-di(ethylidene)quinoxaline.
What is the SMILES notation for (2E,3E)-2,3-di(ethylidene)quinoxaline?
The canonical SMILES for (2E,3E)-2,3-di(ethylidene)quinoxaline is C/C=c1/nc2ccccc2n/c1=C/C.
What is the InChIKey of (2E,3E)-2,3-di(ethylidene)quinoxaline?
The InChIKey is HQZJEAQKCBUGIX-LQIBPGRFSA-N. The full InChI is InChI=1S/C12H12N2/c1-3-9-10(4-2)14-12-8-6-5-7-11(12)13-9/h3-8H,1-2H3/b9-3+,10-4+.
What are the key properties of (2E,3E)-2,3-di(ethylidene)quinoxaline?
(2E,3E)-2,3-di(ethylidene)quinoxaline has a molecular weight of 184.24 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-2,3-di(ethylidene)quinoxaline is sourced from PubChem (CID 59760795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).