C19H30O4 — CID 59761100
dimethyl 2-[(1R,3aR,7aR)-1-[(2S)-butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]propanedioate (PubChem CID 59761100) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is dimethyl 2-[(1R,3aR,7aR)-1-[(2S)-butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]propanedioate.
| Compound Name | dimethyl 2-[(1R,3aR,7aR)-1-[(2S)-butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]propanedioate |
|---|---|
| PubChem CID | 59761100 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | dimethyl 2-[(1R,3aR,7aR)-1-[(2S)-butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]propanedioate |
| SMILES | CC[C@H](C)[C@H]1CC[C@H]2C(=C(C(=O)OC)C(=O)OC)CCC[C@]12C |
| InChI | InChI=1S/C19H30O4/c1-6-12(2)14-9-10-15-13(8-7-11-19(14,15)3)16(17(20)22-4)18(21)23-5/h12,14-15H,6-11H2,1-5H3/t12-,14+,15-,19+/m0/s1 |
| InChIKey | HNCAUJKASBQZKK-OUFKLWKOSA-N |
| XLogP | 3.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|