About (4-benzylphenyl)methanol
(4-benzylphenyl)methanol (PubChem CID 597614) has the molecular formula C14H14O
and a molecular weight of 198.26 g/mol. Its IUPAC name is (4-benzylphenyl)methanol.
Molecular Properties
| Compound Name | (4-benzylphenyl)methanol |
| PubChem CID | 597614 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (4-benzylphenyl)methanol |
| SMILES | OCc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O/c15-11-14-8-6-13(7-9-14)10-12-4-2-1-3-5-12/h1-9,15H,10-11H2 |
| InChIKey | MHZOFWFRCQRXIH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-benzylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzylphenyl)methanol?
The IUPAC name of (4-benzylphenyl)methanol (CID 597614) is (4-benzylphenyl)methanol.
What is the SMILES notation for (4-benzylphenyl)methanol?
The canonical SMILES for (4-benzylphenyl)methanol is OCc1ccc(Cc2ccccc2)cc1.
What is the InChIKey of (4-benzylphenyl)methanol?
The InChIKey is MHZOFWFRCQRXIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O/c15-11-14-8-6-13(7-9-14)10-12-4-2-1-3-5-12/h1-9,15H,10-11H2.
What are the key properties of (4-benzylphenyl)methanol?
(4-benzylphenyl)methanol has a molecular weight of 198.26 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzylphenyl)methanol is sourced from PubChem (CID 597614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).