C11H12N2O6 — CID 59761781
dimethyl 4-amino-3-methyl-5-nitrobenzene-1,2-dicarboxylate (PubChem CID 59761781) has the molecular formula C11H12N2O6 and a molecular weight of 268.23 g/mol. Its IUPAC name is dimethyl 4-amino-3-methyl-5-nitrobenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-amino-3-methyl-5-nitrobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59761781 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | dimethyl 4-amino-3-methyl-5-nitrobenzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N)c(C)c1C(=O)OC |
| InChI | InChI=1S/C11H12N2O6/c1-5-8(11(15)19-3)6(10(14)18-2)4-7(9(5)12)13(16)17/h4H,12H2,1-3H3 |
| InChIKey | QFZCMUULRCKXEA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|