About [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid
[3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid (PubChem CID 59762151) has the molecular formula C13H15BN4O5
and a molecular weight of 318.10 g/mol. Its IUPAC name is [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid.
Molecular Properties
| Compound Name | [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid |
| PubChem CID | 59762151 |
| Molecular Formula | C13H15BN4O5 |
| Molecular Weight | 318.10 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CC(CN2C(=O)c3cc(N)c([N+](=O)[O-])cc3C2=O)C1 |
| InChI | InChI=1S/C13H15BN4O5/c1-14(21)16-4-7(5-16)6-17-12(19)8-2-10(15)11(18(22)23)3-9(8)13(17)20/h2-3,7,21H,4-6,15H2,1H3 |
| InChIKey | YAUIXDHTDPDPQZ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.10 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid?
The IUPAC name of [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid (CID 59762151) is [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid.
What is the SMILES notation for [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid?
The canonical SMILES for [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid is CB(O)N1CC(CN2C(=O)c3cc(N)c([N+](=O)[O-])cc3C2=O)C1.
What is the InChIKey of [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid?
The InChIKey is YAUIXDHTDPDPQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BN4O5/c1-14(21)16-4-7(5-16)6-17-12(19)8-2-10(15)11(18(22)23)3-9(8)13(17)20/h2-3,7,21H,4-6,15H2,1H3.
What are the key properties of [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid?
[3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid has a molecular weight of 318.10 g/mol, XLogP of -0.18, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(5-amino-6-nitro-1,3-dioxoisoindol-2-yl)methyl]azetidin-1-yl]-methylborinic acid is sourced from PubChem (CID 59762151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).