C13H22S — CID 597625
2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene (PubChem CID 597625) has the molecular formula C13H22S and a molecular weight of 210.39 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene.
| Compound Name | 2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene |
|---|---|
| PubChem CID | 597625 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene |
| SMILES | C1CCC2SC3CCCCC3CC2C1 |
| InChI | InChI=1S/C13H22S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h10-13H,1-9H2 |
| InChIKey | FNXIDRVQDNBNQD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |