C11H20O5 — CID 59762526
1-[(3R,4R)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]ethanone (PubChem CID 59762526) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-[(3R,4R)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]ethanone.
| Compound Name | 1-[(3R,4R)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]ethanone |
|---|---|
| PubChem CID | 59762526 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-[(3R,4R)-6-tert-butyl-3,4,5-trihydroxyoxan-2-yl]ethanone |
| SMILES | CC(=O)C1OC(C(C)(C)C)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20O5/c1-5(12)9-7(14)6(13)8(15)10(16-9)11(2,3)4/h6-10,13-15H,1-4H3/t6-,7+,8?,9?,10?/m0/s1 |
| InChIKey | RUNQSOKIBMLUSL-BLHFLBKCSA-N |
| XLogP | -0.53 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |