C54H43EuF3O4P2 — CID 59762603
2-diphenylphosphoryl-1-(2-diphenylphosphorylnaphthalen-1-yl)naphthalene;europium;4,4,4-trifluoro-1-phenylbutane-1,3-diol (PubChem CID 59762603) has the molecular formula C54H43EuF3O4P2 and a molecular weight of 1026.84 g/mol. Its IUPAC name is 2-diphenylphosphoryl-1-(2-diphenylphosphorylnaphthalen-1-yl)naphthalene;europium;4,4,4-trifluoro-1-phenylbutane-1,3-diol.
| Compound Name | 2-diphenylphosphoryl-1-(2-diphenylphosphorylnaphthalen-1-yl)naphthalene;europium;4,4,4-trifluoro-1-phenylbutane-1,3-diol |
|---|---|
| PubChem CID | 59762603 |
| Molecular Formula | C54H43EuF3O4P2 |
| Molecular Weight | 1026.84 g/mol |
| Exact Mass | 1027.18 |
| IUPAC Name | 2-diphenylphosphoryl-1-(2-diphenylphosphorylnaphthalen-1-yl)naphthalene;europium;4,4,4-trifluoro-1-phenylbutane-1,3-diol |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc2ccccc2c1-c1c(P(=O)(c2ccccc2)c2ccccc2)ccc2ccccc12.OC(CC(O)C(F)(F)F)c1ccccc1.[Eu] |
| InChI | InChI=1S/C44H32O2P2.C10H11F3O2.Eu/c45-47(35-19-5-1-6-20-35,36-21-7-2-8-22-36)41-31-29-33-17-13-15-27-39(33)43(41)44-40-28-16-14-18-34(40)30-32-42(44)48(46,37-23-9-3-10-24-37)38-25-11-4-12-26-38;11-10(12,13)9(15)6-8(14)7-4-2-1-3-5-7;/h1-32H;1-5,8-9,14-15H,6H2; |
| InChIKey | DZBHCWOFXCBKNC-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1026.84 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|