C15H17F4NO2 — CID 59762619
(2S,3R)-3-[2-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-methylpropyl]-3-(trifluoromethyl)oxiran-2-amine (PubChem CID 59762619) has the molecular formula C15H17F4NO2 and a molecular weight of 319.30 g/mol. Its IUPAC name is (2S,3R)-3-[2-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-methylpropyl]-3-(trifluoromethyl)oxiran-2-amine.
| Compound Name | (2S,3R)-3-[2-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-methylpropyl]-3-(trifluoromethyl)oxiran-2-amine |
|---|---|
| PubChem CID | 59762619 |
| Molecular Formula | C15H17F4NO2 |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (2S,3R)-3-[2-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-methylpropyl]-3-(trifluoromethyl)oxiran-2-amine |
| SMILES | CC(C)(C[C@@]1(C(F)(F)F)O[C@@H]1N)c1cc(F)cc2c1OCC2 |
| InChI | InChI=1S/C15H17F4NO2/c1-13(2,7-14(12(20)22-14)15(17,18)19)10-6-9(16)5-8-3-4-21-11(8)10/h5-6,12H,3-4,7,20H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | GXJWPSNQKPQVTC-GXTWGEPZSA-N |
| XLogP | 3.04 |
| TPSA | 47.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|