C21H26O — CID 59762662
13-(ethoxymethyl)-5,11-dimethyltricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene (PubChem CID 59762662) has the molecular formula C21H26O and a molecular weight of 294.44 g/mol. Its IUPAC name is 13-(ethoxymethyl)-5,11-dimethyltricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene.
| Compound Name | 13-(ethoxymethyl)-5,11-dimethyltricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
|---|---|
| PubChem CID | 59762662 |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 13-(ethoxymethyl)-5,11-dimethyltricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
| SMILES | CCOCc1cc2c(C)cc1CCc1ccc(cc1C)CC2 |
| InChI | InChI=1S/C21H26O/c1-4-22-14-21-13-19-8-6-17-5-7-18(15(2)11-17)9-10-20(21)12-16(19)3/h5,7,11-13H,4,6,8-10,14H2,1-3H3 |
| InChIKey | JSHLDEQBVBYFAE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |