C49H52OP2 — CID 59762666
[12,15-bis[bis(2,6-dimethylphenyl)phosphanyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]methanol (PubChem CID 59762666) has the molecular formula C49H52OP2 and a molecular weight of 718.90 g/mol. Its IUPAC name is [12,15-bis[bis(2,6-dimethylphenyl)phosphanyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]methanol.
| Compound Name | [12,15-bis[bis(2,6-dimethylphenyl)phosphanyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]methanol |
|---|---|
| PubChem CID | 59762666 |
| Molecular Formula | C49H52OP2 |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 718.35 |
| IUPAC Name | [12,15-bis[bis(2,6-dimethylphenyl)phosphanyl]-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl]methanol |
| SMILES | Cc1cccc(C)c1P(c1cc2c(CO)cc1CCc1ccc(c(P(c3c(C)cccc3C)c3c(C)cccc3C)c1)CC2)c1c(C)cccc1C |
| InChI | InChI=1S/C49H52OP2/c1-31-13-9-14-32(2)46(31)51(47-33(3)15-10-16-34(47)4)44-27-39-21-23-40(44)25-26-41-29-45(42(24-22-39)28-43(41)30-50)52(48-35(5)17-11-18-36(48)6)49-37(7)19-12-20-38(49)8/h9-21,23,27-29,50H,22,24-26,30H2,1-8H3 |
| InChIKey | OEAHNJGCLAKBNE-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|