C23H19ClN6O2 — CID 59762735
3-[[4-(3-chloroanilino)-6-(3-methoxyanilino)-1,3,5-triazin-2-yl]amino]benzaldehyde (PubChem CID 59762735) has the molecular formula C23H19ClN6O2 and a molecular weight of 446.90 g/mol. Its IUPAC name is 3-[[4-(3-chloroanilino)-6-(3-methoxyanilino)-1,3,5-triazin-2-yl]amino]benzaldehyde.
| Compound Name | 3-[[4-(3-chloroanilino)-6-(3-methoxyanilino)-1,3,5-triazin-2-yl]amino]benzaldehyde |
|---|---|
| PubChem CID | 59762735 |
| Molecular Formula | C23H19ClN6O2 |
| Molecular Weight | 446.90 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 3-[[4-(3-chloroanilino)-6-(3-methoxyanilino)-1,3,5-triazin-2-yl]amino]benzaldehyde |
| SMILES | COc1cccc(Nc2nc(Nc3cccc(Cl)c3)nc(Nc3cccc(C=O)c3)n2)c1 |
| InChI | InChI=1S/C23H19ClN6O2/c1-32-20-10-4-9-19(13-20)27-23-29-21(25-17-7-2-5-15(11-17)14-31)28-22(30-23)26-18-8-3-6-16(24)12-18/h2-14H,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | NKBRVTLTMFNNLZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.90 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|