About 3,5-dimethyl-1,3,2-oxazaborolidine
3,5-dimethyl-1,3,2-oxazaborolidine (PubChem CID 59762752) has the molecular formula C4H10BNO
and a molecular weight of 98.94 g/mol. Its IUPAC name is 3,5-dimethyl-1,3,2-oxazaborolidine.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,3,2-oxazaborolidine |
| PubChem CID | 59762752 |
| Molecular Formula | C4H10BNO |
| Molecular Weight | 98.94 g/mol |
| Exact Mass | 99.09 |
| IUPAC Name | 3,5-dimethyl-1,3,2-oxazaborolidine |
| SMILES | CC1CN(C)BO1 |
| InChI | InChI=1S/C4H10BNO/c1-4-3-6(2)5-7-4/h4-5H,3H2,1-2H3 |
| InChIKey | QTMHDQZVMHFZLM-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.94 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1,3,2-oxazaborolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,3,2-oxazaborolidine?
The IUPAC name of 3,5-dimethyl-1,3,2-oxazaborolidine (CID 59762752) is 3,5-dimethyl-1,3,2-oxazaborolidine.
What is the SMILES notation for 3,5-dimethyl-1,3,2-oxazaborolidine?
The canonical SMILES for 3,5-dimethyl-1,3,2-oxazaborolidine is CC1CN(C)BO1.
What is the InChIKey of 3,5-dimethyl-1,3,2-oxazaborolidine?
The InChIKey is QTMHDQZVMHFZLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10BNO/c1-4-3-6(2)5-7-4/h4-5H,3H2,1-2H3.
What are the key properties of 3,5-dimethyl-1,3,2-oxazaborolidine?
3,5-dimethyl-1,3,2-oxazaborolidine has a molecular weight of 98.94 g/mol, XLogP of -0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,3,2-oxazaborolidine is sourced from PubChem (CID 59762752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).