C4H10BNO — CID 59762752
3,5-dimethyl-1,3,2-oxazaborolidine (PubChem CID 59762752) has the molecular formula C4H10BNO and a molecular weight of 98.94 g/mol. Its IUPAC name is 3,5-dimethyl-1,3,2-oxazaborolidine.
| Compound Name | 3,5-dimethyl-1,3,2-oxazaborolidine |
|---|---|
| PubChem CID | 59762752 |
| Molecular Formula | C4H10BNO |
| Molecular Weight | 98.94 g/mol |
| Exact Mass | 99.09 |
| IUPAC Name | 3,5-dimethyl-1,3,2-oxazaborolidine |
| SMILES | CC1CN(C)BO1 |
| InChI | InChI=1S/C4H10BNO/c1-4-3-6(2)5-7-4/h4-5H,3H2,1-2H3 |
| InChIKey | QTMHDQZVMHFZLM-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.94 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|