C17H15BrFN3O4S — CID 59763944
[4-[2-amino-4-(3-bromo-4-fluorophenyl)-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate (PubChem CID 59763944) has the molecular formula C17H15BrFN3O4S and a molecular weight of 456.29 g/mol. Its IUPAC name is [4-[2-amino-4-(3-bromo-4-fluorophenyl)-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate.
| Compound Name | [4-[2-amino-4-(3-bromo-4-fluorophenyl)-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 59763944 |
| Molecular Formula | C17H15BrFN3O4S |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | [4-[2-amino-4-(3-bromo-4-fluorophenyl)-1-methyl-5-oxoimidazol-4-yl]phenyl] methanesulfonate |
| SMILES | CN1C(=O)C(c2ccc(OS(C)(=O)=O)cc2)(c2ccc(F)c(Br)c2)N=C1N |
| InChI | InChI=1S/C17H15BrFN3O4S/c1-22-15(23)17(21-16(22)20,11-5-8-14(19)13(18)9-11)10-3-6-12(7-4-10)26-27(2,24)25/h3-9H,1-2H3,(H2,20,21) |
| InChIKey | JBVBCCFSDJSHAC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|