C25H20ClN5O — CID 59764481
2-[[5-chloro-2-(2-methoxy-5-methyl-4-phenylanilino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 59764481) has the molecular formula C25H20ClN5O and a molecular weight of 441.92 g/mol. Its IUPAC name is 2-[[5-chloro-2-(2-methoxy-5-methyl-4-phenylanilino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 2-[[5-chloro-2-(2-methoxy-5-methyl-4-phenylanilino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 59764481 |
| Molecular Formula | C25H20ClN5O |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 2-[[5-chloro-2-(2-methoxy-5-methyl-4-phenylanilino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | COc1cc(-c2ccccc2)c(C)cc1Nc1ncc(Cl)c(Nc2ccccc2C#N)n1 |
| InChI | InChI=1S/C25H20ClN5O/c1-16-12-22(23(32-2)13-19(16)17-8-4-3-5-9-17)30-25-28-15-20(26)24(31-25)29-21-11-7-6-10-18(21)14-27/h3-13,15H,1-2H3,(H2,28,29,30,31) |
| InChIKey | JIDCQTZXVDJAMT-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |