C17H12F3N5O2 — CID 59764797
1-(benzotriazol-1-yl)-2-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]ethane-1,2-dione (PubChem CID 59764797) has the molecular formula C17H12F3N5O2 and a molecular weight of 375.31 g/mol. Its IUPAC name is 1-(benzotriazol-1-yl)-2-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]ethane-1,2-dione.
| Compound Name | 1-(benzotriazol-1-yl)-2-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 59764797 |
| Molecular Formula | C17H12F3N5O2 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-(benzotriazol-1-yl)-2-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)n1nnc2ccccc21)N1CCc2ncc(C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C17H12F3N5O2/c18-17(19,20)11-7-10-9-24(6-5-12(10)21-8-11)15(26)16(27)25-14-4-2-1-3-13(14)22-23-25/h1-4,7-8H,5-6,9H2 |
| InChIKey | HQMADKPRAOEYSR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|