C17H23Cl2N3O2 — CID 59764811
2-(3,4-dichloroanilino)-1-[(3R)-3-(oxan-4-ylamino)pyrrolidin-1-yl]ethanone (PubChem CID 59764811) has the molecular formula C17H23Cl2N3O2 and a molecular weight of 372.30 g/mol. Its IUPAC name is 2-(3,4-dichloroanilino)-1-[(3R)-3-(oxan-4-ylamino)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(3,4-dichloroanilino)-1-[(3R)-3-(oxan-4-ylamino)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 59764811 |
| Molecular Formula | C17H23Cl2N3O2 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-(3,4-dichloroanilino)-1-[(3R)-3-(oxan-4-ylamino)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(CNc1ccc(Cl)c(Cl)c1)N1CC[C@@H](NC2CCOCC2)C1 |
| InChI | InChI=1S/C17H23Cl2N3O2/c18-15-2-1-13(9-16(15)19)20-10-17(23)22-6-3-14(11-22)21-12-4-7-24-8-5-12/h1-2,9,12,14,20-21H,3-8,10-11H2/t14-/m1/s1 |
| InChIKey | SNVYYSFOXAZAFU-CQSZACIVSA-N |
| XLogP | 2.77 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |