C29H34N4O3 — CID 59765088
tert-butyl N-[4-[4-amino-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-1-yl]butyl]carbamate (PubChem CID 59765088) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is tert-butyl N-[4-[4-amino-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-1-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-amino-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 59765088 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | tert-butyl N-[4-[4-amino-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-1-yl]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCn1cc(-c2cccc(OCc3ccccc3)c2)c2c(N)nccc21 |
| InChI | InChI=1S/C29H34N4O3/c1-29(2,3)36-28(34)32-15-7-8-17-33-19-24(26-25(33)14-16-31-27(26)30)22-12-9-13-23(18-22)35-20-21-10-5-4-6-11-21/h4-6,9-14,16,18-19H,7-8,15,17,20H2,1-3H3,(H2,30,31)(H,32,34) |
| InChIKey | WLNXMWHKQREMAI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|