C28H24FN3O — CID 59765094
N-(3-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 59765094) has the molecular formula C28H24FN3O and a molecular weight of 437.52 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | N-(3-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 59765094 |
| Molecular Formula | C28H24FN3O |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-(3-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | Fc1cccc(Nc2ccnc3[nH]c(-c4cccc(OCCCc5ccccc5)c4)cc23)c1 |
| InChI | InChI=1S/C28H24FN3O/c29-22-11-5-12-23(18-22)31-26-14-15-30-28-25(26)19-27(32-28)21-10-4-13-24(17-21)33-16-6-9-20-7-2-1-3-8-20/h1-5,7-8,10-15,17-19H,6,9,16H2,(H2,30,31,32) |
| InChIKey | XGXKKWFAGAQNHK-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|