C31H38N4O4 — CID 59765096
tert-butyl N-[4-[3-(3-methoxyphenyl)-4-[(4-methoxyphenyl)methylamino]pyrrolo[3,2-c]pyridin-1-yl]butyl]carbamate (PubChem CID 59765096) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is tert-butyl N-[4-[3-(3-methoxyphenyl)-4-[(4-methoxyphenyl)methylamino]pyrrolo[3,2-c]pyridin-1-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-(3-methoxyphenyl)-4-[(4-methoxyphenyl)methylamino]pyrrolo[3,2-c]pyridin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 59765096 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | tert-butyl N-[4-[3-(3-methoxyphenyl)-4-[(4-methoxyphenyl)methylamino]pyrrolo[3,2-c]pyridin-1-yl]butyl]carbamate |
| SMILES | COc1ccc(CNc2nccc3c2c(-c2cccc(OC)c2)cn3CCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C31H38N4O4/c1-31(2,3)39-30(36)33-16-6-7-18-35-21-26(23-9-8-10-25(19-23)38-5)28-27(35)15-17-32-29(28)34-20-22-11-13-24(37-4)14-12-22/h8-15,17,19,21H,6-7,16,18,20H2,1-5H3,(H,32,34)(H,33,36) |
| InChIKey | SZKUFJSEHBLYJC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|