C26H25ClF3N5O2 — CID 59765100
1-[4-[4-amino-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-1-yl]butyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 59765100) has the molecular formula C26H25ClF3N5O2 and a molecular weight of 531.97 g/mol. Its IUPAC name is 1-[4-[4-amino-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-1-yl]butyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[4-amino-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-1-yl]butyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 59765100 |
| Molecular Formula | C26H25ClF3N5O2 |
| Molecular Weight | 531.97 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 1-[4-[4-amino-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-1-yl]butyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1cccc(-c2cn(CCCCNC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c3ccnc(N)c23)c1 |
| InChI | InChI=1S/C26H25ClF3N5O2/c1-37-18-6-4-5-16(13-18)19-15-35(22-9-11-32-24(31)23(19)22)12-3-2-10-33-25(36)34-17-7-8-21(27)20(14-17)26(28,29)30/h4-9,11,13-15H,2-3,10,12H2,1H3,(H2,31,32)(H2,33,34,36) |
| InChIKey | MFNCXZYQCXBYCA-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.97 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|