About 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine
1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine (PubChem CID 59765123) has the molecular formula C24H26N4O
and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine |
| PubChem CID | 59765123 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine |
| SMILES | NCCCCn1cc(-c2cccc(OCc3ccccc3)c2)c2c(N)nccc21 |
| InChI | InChI=1S/C24H26N4O/c25-12-4-5-14-28-16-21(23-22(28)11-13-27-24(23)26)19-9-6-10-20(15-19)29-17-18-7-2-1-3-8-18/h1-3,6-11,13,15-16H,4-5,12,14,17,25H2,(H2,26,27) |
| InChIKey | MBWFQZNGCKTVCD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine?
The IUPAC name of 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine (CID 59765123) is 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine.
What is the SMILES notation for 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine?
The canonical SMILES for 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine is NCCCCn1cc(-c2cccc(OCc3ccccc3)c2)c2c(N)nccc21.
What is the InChIKey of 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine?
The InChIKey is MBWFQZNGCKTVCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N4O/c25-12-4-5-14-28-16-21(23-22(28)11-13-27-24(23)26)19-9-6-10-20(15-19)29-17-18-7-2-1-3-8-18/h1-3,6-11,13,15-16H,4-5,12,14,17,25H2,(H2,26,27).
What are the key properties of 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine?
1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine has a molecular weight of 386.50 g/mol, XLogP of 4.60, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminobutyl)-3-(3-phenylmethoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine is sourced from PubChem (CID 59765123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).