About 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine
1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine (PubChem CID 59765131) has the molecular formula C19H22N4O
and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine |
| PubChem CID | 59765131 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine |
| SMILES | COc1cccc(-c2cn(C3CC(CN)C3)c3ccnc(N)c23)c1 |
| InChI | InChI=1S/C19H22N4O/c1-24-15-4-2-3-13(9-15)16-11-23(14-7-12(8-14)10-20)17-5-6-22-19(21)18(16)17/h2-6,9,11-12,14H,7-8,10,20H2,1H3,(H2,21,22) |
| InChIKey | HFAXUZPAXOPZRF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine?
The IUPAC name of 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine (CID 59765131) is 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine.
What is the SMILES notation for 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine?
The canonical SMILES for 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine is COc1cccc(-c2cn(C3CC(CN)C3)c3ccnc(N)c23)c1.
What is the InChIKey of 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine?
The InChIKey is HFAXUZPAXOPZRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O/c1-24-15-4-2-3-13(9-15)16-11-23(14-7-12(8-14)10-20)17-5-6-22-19(21)18(16)17/h2-6,9,11-12,14H,7-8,10,20H2,1H3,(H2,21,22).
What are the key properties of 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine?
1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine has a molecular weight of 322.41 g/mol, XLogP of 3.20, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(aminomethyl)cyclobutyl]-3-(3-methoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine is sourced from PubChem (CID 59765131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).