About N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine
N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 59765139) has the molecular formula C28H24FN3O
and a molecular weight of 437.52 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine.
Molecular Properties
| Compound Name | N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine |
| PubChem CID | 59765139 |
| Molecular Formula | C28H24FN3O |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | Fc1ccccc1Nc1ccnc2[nH]c(-c3cccc(OCCCc4ccccc4)c3)cc12 |
| InChI | InChI=1S/C28H24FN3O/c29-24-13-4-5-14-26(24)31-25-15-16-30-28-23(25)19-27(32-28)21-11-6-12-22(18-21)33-17-7-10-20-8-2-1-3-9-20/h1-6,8-9,11-16,18-19H,7,10,17H2,(H2,30,31,32) |
| InChIKey | KTTNASVPAVFPOG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine?
The IUPAC name of N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine (CID 59765139) is N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine.
What is the SMILES notation for N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine?
The canonical SMILES for N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine is Fc1ccccc1Nc1ccnc2[nH]c(-c3cccc(OCCCc4ccccc4)c3)cc12.
What is the InChIKey of N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine?
The InChIKey is KTTNASVPAVFPOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24FN3O/c29-24-13-4-5-14-26(24)31-25-15-16-30-28-23(25)19-27(32-28)21-11-6-12-22(18-21)33-17-7-10-20-8-2-1-3-9-20/h1-6,8-9,11-16,18-19H,7,10,17H2,(H2,30,31,32).
What are the key properties of N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine?
N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine has a molecular weight of 437.52 g/mol, XLogP of 7.12, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorophenyl)-2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine is sourced from PubChem (CID 59765139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).