About N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide
N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide (PubChem CID 59765154) has the molecular formula C10H22N2O3S
and a molecular weight of 250.36 g/mol. Its IUPAC name is N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide |
| PubChem CID | 59765154 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide |
| SMILES | C[C@H](CCNS(C)(=O)=O)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H22N2O3S/c1-8(6-7-11-16(5,14)15)12-9(13)10(2,3)4/h8,11H,6-7H2,1-5H3,(H,12,13)/t8-/m1/s1 |
| InChIKey | MWPQCABQZGRVFG-MRVPVSSYSA-N |
| XLogP | 0.48 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide?
The IUPAC name of N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide (CID 59765154) is N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide is C[C@H](CCNS(C)(=O)=O)NC(=O)C(C)(C)C.
What is the InChIKey of N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide?
The InChIKey is MWPQCABQZGRVFG-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H22N2O3S/c1-8(6-7-11-16(5,14)15)12-9(13)10(2,3)4/h8,11H,6-7H2,1-5H3,(H,12,13)/t8-/m1/s1.
What are the key properties of N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide?
N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide has a molecular weight of 250.36 g/mol, XLogP of 0.48, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-4-(methanesulfonamido)butan-2-yl]-2,2-dimethylpropanamide is sourced from PubChem (CID 59765154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).