C17H18KN3O3S — CID 59765193
potassium 1-(1,3-benzodioxol-5-yl)-N-[5-(dimethylaminomethyl)-1,3-thiazol-2-yl]cyclopropane-1-carboxamide (PubChem CID 59765193) has the molecular formula C17H18KN3O3S and a molecular weight of 383.51 g/mol. Its IUPAC name is potassium 1-(1,3-benzodioxol-5-yl)-N-[5-(dimethylaminomethyl)-1,3-thiazol-2-yl]cyclopropane-1-carboxamide.
| Compound Name | potassium 1-(1,3-benzodioxol-5-yl)-N-[5-(dimethylaminomethyl)-1,3-thiazol-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59765193 |
| Molecular Formula | C17H18KN3O3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | potassium 1-(1,3-benzodioxol-5-yl)-N-[5-(dimethylaminomethyl)-1,3-thiazol-2-yl]cyclopropane-1-carboxamide |
| SMILES | CN(C)[CH-]c1cnc(NC(=O)C2(c3ccc4c(c3)OCO4)CC2)s1.[K+] |
| InChI | InChI=1S/C17H18N3O3S.K/c1-20(2)9-12-8-18-16(24-12)19-15(21)17(5-6-17)11-3-4-13-14(7-11)23-10-22-13;/h3-4,7-9H,5-6,10H2,1-2H3,(H,18,19,21);/q-1;+1 |
| InChIKey | SNDGYXNAWHMATM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|