C13H13N3O4S — CID 59765297
3-amino-5-[(3S)-1,3-dimethyl-2,6-dioxopiperidin-3-yl]thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 59765297) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 3-amino-5-[(3S)-1,3-dimethyl-2,6-dioxopiperidin-3-yl]thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-amino-5-[(3S)-1,3-dimethyl-2,6-dioxopiperidin-3-yl]thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 59765297 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3-amino-5-[(3S)-1,3-dimethyl-2,6-dioxopiperidin-3-yl]thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CN1C(=O)CC[C@](C)(N2C(=O)c3csc(N)c3C2=O)C1=O |
| InChI | InChI=1S/C13H13N3O4S/c1-13(4-3-7(17)15(2)12(13)20)16-10(18)6-5-21-9(14)8(6)11(16)19/h5H,3-4,14H2,1-2H3/t13-/m0/s1 |
| InChIKey | FNXNVENLUWYNAW-ZDUSSCGKSA-N |
| XLogP | 0.46 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|