C15H17N3O4S — CID 59765303
3-amino-5-[(3S)-3-methyl-2,6-dioxo-1-propylpiperidin-3-yl]thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 59765303) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is 3-amino-5-[(3S)-3-methyl-2,6-dioxo-1-propylpiperidin-3-yl]thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-amino-5-[(3S)-3-methyl-2,6-dioxo-1-propylpiperidin-3-yl]thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 59765303 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 3-amino-5-[(3S)-3-methyl-2,6-dioxo-1-propylpiperidin-3-yl]thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCN1C(=O)CC[C@](C)(N2C(=O)c3csc(N)c3C2=O)C1=O |
| InChI | InChI=1S/C15H17N3O4S/c1-3-6-17-9(19)4-5-15(2,14(17)22)18-12(20)8-7-23-11(16)10(8)13(18)21/h7H,3-6,16H2,1-2H3/t15-/m0/s1 |
| InChIKey | JEALSMHCDJTKQB-HNNXBMFYSA-N |
| XLogP | 1.24 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|