C15H17N3O4S — CID 59765318
5-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-3-(propylamino)thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 59765318) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is 5-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-3-(propylamino)thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 5-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-3-(propylamino)thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 59765318 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-3-(propylamino)thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCNc1scc2c1C(=O)N([C@@]1(C)CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H17N3O4S/c1-3-6-16-11-10-8(7-23-11)12(20)18(13(10)21)15(2)5-4-9(19)17-14(15)22/h7,16H,3-6H2,1-2H3,(H,17,19,22)/t15-/m0/s1 |
| InChIKey | CJUIFSGEOYBBOK-HNNXBMFYSA-N |
| XLogP | 1.36 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|