C35H35ClN4O4S — CID 59765405
9H-fluoren-9-ylmethyl (2S,4R)-2-[(5-carbamimidoylthiophen-2-yl)methyl-ethylcarbamoyl]-4-[(4-chlorophenyl)methoxy]pyrrolidine-1-carboxylate (PubChem CID 59765405) has the molecular formula C35H35ClN4O4S and a molecular weight of 643.21 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2S,4R)-2-[(5-carbamimidoylthiophen-2-yl)methyl-ethylcarbamoyl]-4-[(4-chlorophenyl)methoxy]pyrrolidine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2S,4R)-2-[(5-carbamimidoylthiophen-2-yl)methyl-ethylcarbamoyl]-4-[(4-chlorophenyl)methoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59765405 |
| Molecular Formula | C35H35ClN4O4S |
| Molecular Weight | 643.21 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2S,4R)-2-[(5-carbamimidoylthiophen-2-yl)methyl-ethylcarbamoyl]-4-[(4-chlorophenyl)methoxy]pyrrolidine-1-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(CN(CC)C(=O)[C@@H]2C[C@@H](OCc3ccc(Cl)cc3)CN2C(=O)OCC2c3ccccc3-c3ccccc32)s1 |
| InChI | InChI=1S/C35H35ClN4O4S/c1-2-39(19-25-15-16-32(45-25)33(37)38)34(41)31-17-24(43-20-22-11-13-23(36)14-12-22)18-40(31)35(42)44-21-30-28-9-5-3-7-26(28)27-8-4-6-10-29(27)30/h3-16,24,30-31H,2,17-21H2,1H3,(H3,37,38)/t24-,31+/m1/s1 |
| InChIKey | XQUGHAQHZFYETQ-XJFCNFDWSA-N |
| XLogP | 6.64 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.21 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|