About 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol
5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol (PubChem CID 59765769) has the molecular formula C18H30O5SSi
and a molecular weight of 386.59 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol.
Molecular Properties
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol |
| PubChem CID | 59765769 |
| Molecular Formula | C18H30O5SSi |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC1C(Sc2ccccc2)OC(CO)C(O)C1O |
| InChI | InChI=1S/C18H30O5SSi/c1-18(2,3)25(4,5)23-16-15(21)14(20)13(11-19)22-17(16)24-12-9-7-6-8-10-12/h6-10,13-17,19-21H,11H2,1-5H3 |
| InChIKey | YWTIBMBORDRIGK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol?
The IUPAC name of 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol (CID 59765769) is 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol.
What is the SMILES notation for 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol?
The canonical SMILES for 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol is CC(C)(C)[Si](C)(C)OC1C(Sc2ccccc2)OC(CO)C(O)C1O.
What is the InChIKey of 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol?
The InChIKey is YWTIBMBORDRIGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O5SSi/c1-18(2,3)25(4,5)23-16-15(21)14(20)13(11-19)22-17(16)24-12-9-7-6-8-10-12/h6-10,13-17,19-21H,11H2,1-5H3.
What are the key properties of 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol?
5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol has a molecular weight of 386.59 g/mol, XLogP of 2.61, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol is sourced from PubChem (CID 59765769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).