C15H19FO4S — CID 59765839
S-phenyl (3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-3-hydroxy-2-methylpropanethioate (PubChem CID 59765839) has the molecular formula C15H19FO4S and a molecular weight of 314.38 g/mol. Its IUPAC name is S-phenyl (3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-3-hydroxy-2-methylpropanethioate.
| Compound Name | S-phenyl (3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-3-hydroxy-2-methylpropanethioate |
|---|---|
| PubChem CID | 59765839 |
| Molecular Formula | C15H19FO4S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | S-phenyl (3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-3-hydroxy-2-methylpropanethioate |
| SMILES | CC1(C)OC[C@H]([C@@H](O)C(C)(F)C(=O)Sc2ccccc2)O1 |
| InChI | InChI=1S/C15H19FO4S/c1-14(2)19-9-11(20-14)12(17)15(3,16)13(18)21-10-7-5-4-6-8-10/h4-8,11-12,17H,9H2,1-3H3/t11-,12-,15?/m1/s1 |
| InChIKey | MDIDUOCAOGVGHD-IQQIRFCMSA-N |
| XLogP | 2.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|