C12H27N9 — CID 59765899
2-N,4-N,6-N-tris(2-aminopropyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 59765899) has the molecular formula C12H27N9 and a molecular weight of 297.41 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(2-aminopropyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris(2-aminopropyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 59765899 |
| Molecular Formula | C12H27N9 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 2-N,4-N,6-N-tris(2-aminopropyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(N)CNc1nc(NCC(C)N)nc(NCC(C)N)n1 |
| InChI | InChI=1S/C12H27N9/c1-7(13)4-16-10-19-11(17-5-8(2)14)21-12(20-10)18-6-9(3)15/h7-9H,4-6,13-15H2,1-3H3,(H3,16,17,18,19,20,21) |
| InChIKey | XJZWIYQJUJSMQO-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 152.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |