About (4R)-4,5-bis(azidomethyl)cyclohexene
(4R)-4,5-bis(azidomethyl)cyclohexene (PubChem CID 59766093) has the molecular formula C8H12N6
and a molecular weight of 192.23 g/mol. Its IUPAC name is (4R)-4,5-bis(azidomethyl)cyclohexene.
Molecular Properties
| Compound Name | (4R)-4,5-bis(azidomethyl)cyclohexene |
| PubChem CID | 59766093 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | (4R)-4,5-bis(azidomethyl)cyclohexene |
| SMILES | [N-]=[N+]=NCC1CC=CC[C@H]1CN=[N+]=[N-] |
| InChI | InChI=1S/C8H12N6/c9-13-11-5-7-3-1-2-4-8(7)6-12-14-10/h1-2,7-8H,3-6H2/t7-,8?/m0/s1 |
| InChIKey | BRUIMOOUTMMVOS-JAMMHHFISA-N |
| XLogP | 3.19 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4,5-bis(azidomethyl)cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4,5-bis(azidomethyl)cyclohexene?
The IUPAC name of (4R)-4,5-bis(azidomethyl)cyclohexene (CID 59766093) is (4R)-4,5-bis(azidomethyl)cyclohexene.
What is the SMILES notation for (4R)-4,5-bis(azidomethyl)cyclohexene?
The canonical SMILES for (4R)-4,5-bis(azidomethyl)cyclohexene is [N-]=[N+]=NCC1CC=CC[C@H]1CN=[N+]=[N-].
What is the InChIKey of (4R)-4,5-bis(azidomethyl)cyclohexene?
The InChIKey is BRUIMOOUTMMVOS-JAMMHHFISA-N. The full InChI is InChI=1S/C8H12N6/c9-13-11-5-7-3-1-2-4-8(7)6-12-14-10/h1-2,7-8H,3-6H2/t7-,8?/m0/s1.
What are the key properties of (4R)-4,5-bis(azidomethyl)cyclohexene?
(4R)-4,5-bis(azidomethyl)cyclohexene has a molecular weight of 192.23 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4,5-bis(azidomethyl)cyclohexene is sourced from PubChem (CID 59766093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).