About [1]benzothiolo[2,3-f][1]benzofuran-1-one
[1]benzothiolo[2,3-f][1]benzofuran-1-one (PubChem CID 59766139) has the molecular formula C14H8O2S
and a molecular weight of 240.28 g/mol. Its IUPAC name is [1]benzothiolo[2,3-f][1]benzofuran-1-one.
Molecular Properties
| Compound Name | [1]benzothiolo[2,3-f][1]benzofuran-1-one |
| PubChem CID | 59766139 |
| Molecular Formula | C14H8O2S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | [1]benzothiolo[2,3-f][1]benzofuran-1-one |
| SMILES | O=C1COc2cc3c(cc21)sc1ccccc13 |
| InChI | InChI=1S/C14H8O2S/c15-11-7-16-12-5-9-8-3-1-2-4-13(8)17-14(9)6-10(11)12/h1-6H,7H2 |
| InChIKey | RRVSCUGLUOJGHW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1]benzothiolo[2,3-f][1]benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzothiolo[2,3-f][1]benzofuran-1-one?
The IUPAC name of [1]benzothiolo[2,3-f][1]benzofuran-1-one (CID 59766139) is [1]benzothiolo[2,3-f][1]benzofuran-1-one.
What is the SMILES notation for [1]benzothiolo[2,3-f][1]benzofuran-1-one?
The canonical SMILES for [1]benzothiolo[2,3-f][1]benzofuran-1-one is O=C1COc2cc3c(cc21)sc1ccccc13.
What is the InChIKey of [1]benzothiolo[2,3-f][1]benzofuran-1-one?
The InChIKey is RRVSCUGLUOJGHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O2S/c15-11-7-16-12-5-9-8-3-1-2-4-13(8)17-14(9)6-10(11)12/h1-6H,7H2.
What are the key properties of [1]benzothiolo[2,3-f][1]benzofuran-1-one?
[1]benzothiolo[2,3-f][1]benzofuran-1-one has a molecular weight of 240.28 g/mol, XLogP of 3.63, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzothiolo[2,3-f][1]benzofuran-1-one is sourced from PubChem (CID 59766139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).