C16H14Br2O2 — CID 59766462
2,6-dibromo-9,10-dimethylanthracene-9,10-diol (PubChem CID 59766462) has the molecular formula C16H14Br2O2 and a molecular weight of 398.09 g/mol. Its IUPAC name is 2,6-dibromo-9,10-dimethylanthracene-9,10-diol.
| Compound Name | 2,6-dibromo-9,10-dimethylanthracene-9,10-diol |
|---|---|
| PubChem CID | 59766462 |
| Molecular Formula | C16H14Br2O2 |
| Molecular Weight | 398.09 g/mol |
| Exact Mass | 395.94 |
| IUPAC Name | 2,6-dibromo-9,10-dimethylanthracene-9,10-diol |
| SMILES | CC1(O)c2ccc(Br)cc2C(C)(O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C16H14Br2O2/c1-15(19)11-5-3-10(18)8-14(11)16(2,20)12-6-4-9(17)7-13(12)15/h3-8,19-20H,1-2H3 |
| InChIKey | FQBOGUGIHGMQNE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.09 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |