About 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one
4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one (PubChem CID 59766689) has the molecular formula C9H13FN4O
and a molecular weight of 212.23 g/mol. Its IUPAC name is 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one |
| PubChem CID | 59766689 |
| Molecular Formula | C9H13FN4O |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one |
| SMILES | Nc1nc(=O)n([C@H]2CC[C@H](N)C2)cc1F |
| InChI | InChI=1S/C9H13FN4O/c10-7-4-14(9(15)13-8(7)12)6-2-1-5(11)3-6/h4-6H,1-3,11H2,(H2,12,13,15)/t5-,6-/m0/s1 |
| InChIKey | JVWQGEYJWIDMQP-WDSKDSINSA-N |
| XLogP | 0.02 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one?
The IUPAC name of 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one (CID 59766689) is 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one.
What is the SMILES notation for 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one?
The canonical SMILES for 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one is Nc1nc(=O)n([C@H]2CC[C@H](N)C2)cc1F.
What is the InChIKey of 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one?
The InChIKey is JVWQGEYJWIDMQP-WDSKDSINSA-N. The full InChI is InChI=1S/C9H13FN4O/c10-7-4-14(9(15)13-8(7)12)6-2-1-5(11)3-6/h4-6H,1-3,11H2,(H2,12,13,15)/t5-,6-/m0/s1.
What are the key properties of 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one?
4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one has a molecular weight of 212.23 g/mol, XLogP of 0.02, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[(1S,3S)-3-aminocyclopentyl]-5-fluoropyrimidin-2-one is sourced from PubChem (CID 59766689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).