About 7-tert-butyl-4-methylthieno[2,3-d]pyridazine
7-tert-butyl-4-methylthieno[2,3-d]pyridazine (PubChem CID 59767010) has the molecular formula C11H14N2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is 7-tert-butyl-4-methylthieno[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 7-tert-butyl-4-methylthieno[2,3-d]pyridazine |
| PubChem CID | 59767010 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 7-tert-butyl-4-methylthieno[2,3-d]pyridazine |
| SMILES | Cc1nnc(C(C)(C)C)c2sccc12 |
| InChI | InChI=1S/C11H14N2S/c1-7-8-5-6-14-9(8)10(13-12-7)11(2,3)4/h5-6H,1-4H3 |
| InChIKey | ZZEIYJPOBOVLPI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-tert-butyl-4-methylthieno[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-4-methylthieno[2,3-d]pyridazine?
The IUPAC name of 7-tert-butyl-4-methylthieno[2,3-d]pyridazine (CID 59767010) is 7-tert-butyl-4-methylthieno[2,3-d]pyridazine.
What is the SMILES notation for 7-tert-butyl-4-methylthieno[2,3-d]pyridazine?
The canonical SMILES for 7-tert-butyl-4-methylthieno[2,3-d]pyridazine is Cc1nnc(C(C)(C)C)c2sccc12.
What is the InChIKey of 7-tert-butyl-4-methylthieno[2,3-d]pyridazine?
The InChIKey is ZZEIYJPOBOVLPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2S/c1-7-8-5-6-14-9(8)10(13-12-7)11(2,3)4/h5-6H,1-4H3.
What are the key properties of 7-tert-butyl-4-methylthieno[2,3-d]pyridazine?
7-tert-butyl-4-methylthieno[2,3-d]pyridazine has a molecular weight of 206.31 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-4-methylthieno[2,3-d]pyridazine is sourced from PubChem (CID 59767010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).