C24H22BrN3O4S — CID 59767035
ethyl 2-[4-bromo-10-(4-methoxyphenyl)-14-oxo-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-13-yl]acetate (PubChem CID 59767035) has the molecular formula C24H22BrN3O4S and a molecular weight of 528.43 g/mol. Its IUPAC name is ethyl 2-[4-bromo-10-(4-methoxyphenyl)-14-oxo-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-13-yl]acetate.
| Compound Name | ethyl 2-[4-bromo-10-(4-methoxyphenyl)-14-oxo-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-13-yl]acetate |
|---|---|
| PubChem CID | 59767035 |
| Molecular Formula | C24H22BrN3O4S |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | ethyl 2-[4-bromo-10-(4-methoxyphenyl)-14-oxo-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-13-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C2Cc3c([nH]c4ccc(Br)cc34)C(c3ccc(OC)cc3)N2C1=S |
| InChI | InChI=1S/C24H22BrN3O4S/c1-3-32-20(29)12-27-23(30)19-11-17-16-10-14(25)6-9-18(16)26-21(17)22(28(19)24(27)33)13-4-7-15(31-2)8-5-13/h4-10,19,22,26H,3,11-12H2,1-2H3 |
| InChIKey | KWWOJFGJEVHMJY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|