C29H33BrN4O4S — CID 59767056
4-bromo-13-(3-methoxypropyl)-10-[4-(2-morpholin-4-ylethoxy)phenyl]-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one (PubChem CID 59767056) has the molecular formula C29H33BrN4O4S and a molecular weight of 613.58 g/mol. Its IUPAC name is 4-bromo-13-(3-methoxypropyl)-10-[4-(2-morpholin-4-ylethoxy)phenyl]-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one.
| Compound Name | 4-bromo-13-(3-methoxypropyl)-10-[4-(2-morpholin-4-ylethoxy)phenyl]-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
|---|---|
| PubChem CID | 59767056 |
| Molecular Formula | C29H33BrN4O4S |
| Molecular Weight | 613.58 g/mol |
| Exact Mass | 612.14 |
| IUPAC Name | 4-bromo-13-(3-methoxypropyl)-10-[4-(2-morpholin-4-ylethoxy)phenyl]-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-14-one |
| SMILES | COCCCN1C(=O)C2Cc3c([nH]c4ccc(Br)cc34)C(c3ccc(OCCN4CCOCC4)cc3)N2C1=S |
| InChI | InChI=1S/C29H33BrN4O4S/c1-36-13-2-9-33-28(35)25-18-23-22-17-20(30)5-8-24(22)31-26(23)27(34(25)29(33)39)19-3-6-21(7-4-19)38-16-12-32-10-14-37-15-11-32/h3-8,17,25,27,31H,2,9-16,18H2,1H3 |
| InChIKey | DMEGKURDKQMCSU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 70.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|