C26H26BrN3O4S — CID 59767065
ethyl 3-[4-bromo-10-(4-methoxyphenyl)-14-oxo-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-13-yl]butanoate (PubChem CID 59767065) has the molecular formula C26H26BrN3O4S and a molecular weight of 556.48 g/mol. Its IUPAC name is ethyl 3-[4-bromo-10-(4-methoxyphenyl)-14-oxo-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-13-yl]butanoate.
| Compound Name | ethyl 3-[4-bromo-10-(4-methoxyphenyl)-14-oxo-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-13-yl]butanoate |
|---|---|
| PubChem CID | 59767065 |
| Molecular Formula | C26H26BrN3O4S |
| Molecular Weight | 556.48 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | ethyl 3-[4-bromo-10-(4-methoxyphenyl)-14-oxo-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraen-13-yl]butanoate |
| SMILES | CCOC(=O)CC(C)N1C(=O)C2Cc3c([nH]c4ccc(Br)cc34)C(c3ccc(OC)cc3)N2C1=S |
| InChI | InChI=1S/C26H26BrN3O4S/c1-4-34-22(31)11-14(2)29-25(32)21-13-19-18-12-16(27)7-10-20(18)28-23(19)24(30(21)26(29)35)15-5-8-17(33-3)9-6-15/h5-10,12,14,21,24,28H,4,11,13H2,1-3H3 |
| InChIKey | VNWDXAFZRRYEHM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|