C26H20ClN3OS — CID 59767076
10-(3-chlorophenyl)-13-(2-methylphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one (PubChem CID 59767076) has the molecular formula C26H20ClN3OS and a molecular weight of 457.99 g/mol. Its IUPAC name is 10-(3-chlorophenyl)-13-(2-methylphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one.
| Compound Name | 10-(3-chlorophenyl)-13-(2-methylphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one |
|---|---|
| PubChem CID | 59767076 |
| Molecular Formula | C26H20ClN3OS |
| Molecular Weight | 457.99 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 10-(3-chlorophenyl)-13-(2-methylphenyl)-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-14-one |
| SMILES | Cc1ccccc1N1C(=O)C2Cc3c([nH]c4ccccc34)C(c3cccc(Cl)c3)N2C1=S |
| InChI | InChI=1S/C26H20ClN3OS/c1-15-7-2-5-12-21(15)30-25(31)22-14-19-18-10-3-4-11-20(18)28-23(19)24(29(22)26(30)32)16-8-6-9-17(27)13-16/h2-13,22,24,28H,14H2,1H3 |
| InChIKey | WJOIELBHJXLPSG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.99 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|